CAS 1431962-30-9

1H-Pyrazole-4-ethanamine, 1-methyl-, hydrochloride (1:2)

Description:

1H-Pyrazole-4-ethanamine, 1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features an ethylamine side chain and a methyl group attached to the pyrazole ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the hydrochloride group also indicates that it can form stable complexes with other compounds, which is advantageous in drug formulation. The compound may exhibit biological activity, making it of interest in medicinal chemistry, although specific pharmacological properties would require further investigation. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound represents a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₆H₁₁N₃·2ClH

InChI: InChI=1S/C6H11N3.2ClH/c1-9-5-6(2-3-7)4-8-9;;/h4-5H,2-3,7H2,1H3;2*1H

InChI key: InChIKey=YNSWHCYQDWIUEW-UHFFFAOYSA-N

SMILES: C(CN)C1=CN(C)N=C1.Cl

Synonyms:

• 1H-Pyrazole-4-ethanamine, 1-methyl-, hydrochloride (1:2)

[2-(1-methyl-1H-pyrazol-4-yl)ethyl]amine dihydrochloride

CAS: 1431962-30-9

Formula: C₆H₁₃Cl₂N₃

Molecular weight: 198.0935

Ref: IN-DA00J31L

2-(1-Methyl-1H-pyrazol-4-yl)ethan-1-amine dihydrochloride

CAS: 1431962-30-9

Versatile small molecule scaffold

Formula: C₆H₁₃Cl₂N₃

Purity: Min. 95%

Molecular weight: 198.09 g/mol

Ref: 3D-GHC96230