CAS 1431963-11-9

1H-Pyrazol-4-amine, 3-(2,2-difluoroethoxy)-1-methyl-, hydrochloride (1:1)

Description:

1H-Pyrazol-4-amine, 3-(2,2-difluoroethoxy)-1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of the 2,2-difluoroethoxy group introduces significant polarity and potential for hydrogen bonding, influencing its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability in pharmaceutical applications. The compound may exhibit biological activity, potentially serving as a pharmacophore in drug development, particularly in areas such as anti-inflammatory or anti-cancer therapies. Its molecular structure suggests that it may interact with various biological targets, making it of interest in medicinal chemistry. Additionally, the presence of fluorine atoms can enhance metabolic stability and lipophilicity, which are desirable traits in drug design. Overall, this compound represents a unique combination of structural features that may contribute to its functional properties in chemical and biological contexts.

Formula: C₆H₉F₂N₃O·ClH

InChI: InChI=1S/C6H9F2N3O.ClH/c1-11-2-4(9)6(10-11)12-3-5(7)8;/h2,5H,3,9H2,1H3;1H

InChI key: InChIKey=IKVWDZVPNRAFMC-UHFFFAOYSA-N

SMILES: O(CC(F)F)C1=NN(C)C=C1N.Cl

Synonyms:

• 1H-Pyrazol-4-amine, 3-(2,2-difluoroethoxy)-1-methyl-, hydrochloride (1:1)

3-(2,2-Difluoroethoxy)-1-methyl-1H-pyrazol-4-amine hydrochloride

CAS: 1431963-11-9

Versatile small molecule scaffold

Formula: C₆H₁₀ClF₂N₃O

Purity: Min. 95%

Molecular weight: 213.61 g/mol

Ref: 3D-GHC96311