CAS 1431963-32-4

3-Piperidinecarboxylic acid, 1-[(1-methyl-1H-pyrazol-4-yl)methyl]-, hydrochloride (1:2)

Description:

3-Piperidinecarboxylic acid, 1-[(1-methyl-1H-pyrazol-4-yl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and pyrazole moieties, which contribute to its biological activity and potential pharmacological applications. The presence of the piperidine ring provides basic properties, while the carboxylic acid group enhances its solubility in polar solvents and may influence its interaction with biological targets. The hydrochloride form indicates that the compound is a salt, which typically improves stability and solubility in aqueous environments. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its structure suggests potential interactions with receptors or enzymes, particularly in the central nervous system or other therapeutic areas. As with many compounds containing heterocycles, it may also display unique reactivity patterns, making it a candidate for further synthetic modifications or studies in structure-activity relationships. Overall, this compound represents a class of substances that could be valuable in pharmaceutical research.

Formula: C₁₁H₁₇N₃O₂·2ClH

InChI: InChI=1S/C11H17N3O2.2ClH/c1-13-6-9(5-12-13)7-14-4-2-3-10(8-14)11(15)16;;/h5-6,10H,2-4,7-8H2,1H3,(H,15,16);2*1H

InChI key: InChIKey=AYLHRBWGERHPKZ-UHFFFAOYSA-N

SMILES: C(N1CC(C(O)=O)CCC1)C=2C=NN(C)C2.Cl

Synonyms:

• 3-Piperidinecarboxylic acid, 1-[(1-methyl-1H-pyrazol-4-yl)methyl]-, hydrochloride (1:2)

1-[(1-Methyl-1H-pyrazol-4-yl)methyl]piperidine-3-carboxylic acid dihydrochloride

CAS: 1431963-32-4

Versatile small molecule scaffold

Formula: C₁₁H₁₉Cl₂N₃O₂

Purity: Min. 95%

Molecular weight: 296.19 g/mol

Ref: 3D-GHC96332