CAS 1431963-38-0

1H-Pyrido[3,4-b]indole, 1-(4-fluorophenyl)-2,3,4,9-tetrahydro-6-methyl-, hydrochloride (1:1)

Description:

1H-Pyrido[3,4-b]indole, 1-(4-fluorophenyl)-2,3,4,9-tetrahydro-6-methyl-, hydrochloride (1:1) is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and indole moieties. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a fluorophenyl substituent that enhances its pharmacological properties. The hydrochloride salt form suggests increased solubility in aqueous environments, making it suitable for various applications, particularly in medicinal chemistry. The presence of the methyl group at the 6-position of the indole ring may influence its biological activity and interaction with receptors. As a compound of interest, it may exhibit potential therapeutic effects, possibly in the realm of neuropharmacology or oncology, although specific biological activities would require further investigation. Safety and handling precautions should be observed due to the potential for toxicity associated with similar compounds. Overall, this substance represents a unique blend of structural features that may contribute to its functional properties in chemical and biological contexts.

Formula: C₁₈H₁₇FN₂·ClH

InChI: InChI=1S/C18H17FN2.ClH/c1-11-2-7-16-15(10-11)14-8-9-20-17(18(14)21-16)12-3-5-13(19)6-4-12;/h2-7,10,17,20-21H,8-9H2,1H3;1H

InChI key: InChIKey=OFCDEWUVGUKJJS-UHFFFAOYSA-N

SMILES: CC=1C=C2C3=C(C(NCC3)C4=CC=C(F)C=C4)NC2=CC1.Cl

Synonyms:

• 1H-Pyrido[3,4-b]indole, 1-(4-fluorophenyl)-2,3,4,9-tetrahydro-6-methyl-, hydrochloride (1:1)

1-(4-Fluorophenyl)-6-methyl-1H,2H,3H,4H,9H-pyrido[3,4-b]indole hydrochloride

CAS: 1431963-38-0

Versatile small molecule scaffold

Formula: C₁₈H₁₈ClFN₂

Purity: Min. 95%

Molecular weight: 316.8 g/mol

Ref: 3D-GHC96338