CAS 1431963-63-1

2-Furancarboxylic acid, 5-[(3-amino-1H-pyrazol-1-yl)methyl]-, hydrochloride (1:1)

Description:

2-Furancarboxylic acid, 5-[(3-amino-1H-pyrazol-1-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a furan ring and a pyrazole moiety. The presence of the carboxylic acid group contributes to its acidic properties, while the hydrochloride form indicates that it is a salt, enhancing its solubility in water. This compound may exhibit biological activity due to the amino group on the pyrazole, which can participate in various biochemical interactions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in drug development, where such heterocyclic compounds are often explored for their therapeutic properties. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, making it a subject of interest in organic synthesis and medicinal chemistry. Overall, 2-Furancarboxylic acid, 5-[(3-amino-1H-pyrazol-1-yl)methyl]-, hydrochloride (1:1) represents a versatile chemical entity with potential applications in various fields of research.

Formula: C₉H₉N₃O₃·ClH

InChI: InChI=1S/C9H9N3O3.ClH/c10-8-3-4-12(11-8)5-6-1-2-7(15-6)9(13)14;/h1-4H,5H2,(H2,10,11)(H,13,14);1H

InChI key: InChIKey=LCFUGXBOFYYPBU-UHFFFAOYSA-N

SMILES: C(C=1OC(C(O)=O)=CC1)N2N=C(N)C=C2.Cl

Synonyms:

• 2-Furancarboxylic acid, 5-[(3-amino-1H-pyrazol-1-yl)methyl]-, hydrochloride (1:1)

5-[(3-Amino-1H-pyrazol-1-yl)methyl]furan-2-carboxylic acid hydrochloride

CAS: 1431963-63-1

Versatile small molecule scaffold

Formula: C₉H₁₀ClN₃O₃

Purity: Min. 95%

Molecular weight: 243.65 g/mol

Ref: 3D-GHC96363