CAS 1431963-67-5

1H-Pyrazole-1-propanamine, 3-ethoxy-4-nitro-, hydrochloride (1:1)

Description:

1H-Pyrazole-1-propanamine, 3-ethoxy-4-nitro-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a propanamine side chain, contributing to its amine functionality, and an ethoxy group that enhances its solubility and reactivity. The presence of a nitro group at the 4-position of the aromatic system introduces significant electron-withdrawing characteristics, which can influence the compound's reactivity and biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and research. The compound's structure suggests potential uses in medicinal chemistry, particularly in the development of agents targeting specific biological pathways. Safety data and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity associated with its functional groups.

Formula: C₈H₁₄N₄O₃·ClH

InChI: InChI=1S/C8H14N4O3.ClH/c1-2-15-8-7(12(13)14)6-11(10-8)5-3-4-9;/h6H,2-5,9H2,1H3;1H

InChI key: InChIKey=JSTPKXQYSUWLNL-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C(OCC)=NN(CCCN)C1.Cl

Synonyms:

• 1H-Pyrazole-1-propanamine, 3-ethoxy-4-nitro-, hydrochloride (1:1)

3-(3-Ethoxy-4-nitro-1H-pyrazol-1-yl)propan-1-amine hydrochloride

CAS: 1431963-67-5

Versatile small molecule scaffold

Formula: C₈H₁₅ClN₄O₃

Purity: Min. 95%

Molecular weight: 250.68 g/mol

Ref: 3D-GHC96367