CAS 1431963-84-6

Benzenamine, 3-fluoro-4-(2,2,2-trifluoroethoxy)-, hydrochloride (1:1)

Description:

Benzenamine, 3-fluoro-4-(2,2,2-trifluoroethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its aromatic amine structure, which includes a fluorinated benzene ring and a trifluoroethoxy substituent. The presence of the fluorine atoms enhances its lipophilicity and may influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceuticals. The compound's molecular structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Its unique properties may also make it suitable for research in materials science or agrochemicals. Safety data should be consulted to understand its toxicity and handling requirements, as compounds with fluorinated groups can exhibit distinct environmental and health impacts. Overall, this compound exemplifies the intersection of organic chemistry and functional applications in various scientific fields.

Formula: C₈H₇F₄NO·ClH

InChI: InChI=1S/C8H7F4NO.ClH/c9-6-3-5(13)1-2-7(6)14-4-8(10,11)12;/h1-3H,4,13H2;1H

InChI key: InChIKey=ICIHYAWVFNVJKA-UHFFFAOYSA-N

SMILES: O(CC(F)(F)F)C1=C(F)C=C(N)C=C1.Cl

Synonyms:

• Benzenamine, 3-fluoro-4-(2,2,2-trifluoroethoxy)-, hydrochloride (1:1)

3-Fluoro-4-(2,2,2-trifluoroethoxy)aniline hydrochloride

CAS: 1431963-84-6

3-Fluoro-4-(2,2,2-trifluoroethoxy)aniline hydrochloride

Purity: ≥95%

Molecular weight: 245.60g/mol

Ref: 54-PC410092

[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]amine

CAS: 1431963-84-6

Formula: C₈H₈ClF₄NO

Molecular weight: 245.6

Ref: 10-F427854