CAS 1431964-05-4

Benzenamine, 5-fluoro-2-(1H-imidazol-1-yl)-, hydrochloride (1:2)

Description:

Benzenamine, 5-fluoro-2-(1H-imidazol-1-yl)-, hydrochloride (1:2) is a chemical compound characterized by its structure, which includes a benzene ring substituted with an amino group and a fluorine atom, as well as an imidazole moiety. This compound is typically encountered as a hydrochloride salt, indicating that it is a protonated form of the base, which enhances its solubility in water and stability. The presence of the fluorine atom can influence the compound's electronic properties and biological activity, making it of interest in pharmaceutical research. The imidazole ring contributes to its potential as a ligand in coordination chemistry and its reactivity in various organic synthesis pathways. As with many amines, it may exhibit basic properties, allowing it to participate in acid-base reactions. The compound's specific applications and biological activities would depend on its interactions with biological targets, which are often explored in medicinal chemistry contexts. Safety data and handling precautions should be considered due to its classification and potential toxicity.

Formula: C₉H₈FN₃·2ClH

InChI: InChI=1S/C9H8FN3.2ClH/c10-7-1-2-9(8(11)5-7)13-4-3-12-6-13;;/h1-6H,11H2;2*1H

InChI key: InChIKey=VYPNCNOMUXNJGK-UHFFFAOYSA-N

SMILES: NC1=C(N2C=CN=C2)C=CC(F)=C1.Cl

Synonyms:

• Benzenamine, 5-fluoro-2-(1H-imidazol-1-yl)-, hydrochloride (1:2)

5-Fluoro-2-(1H-imidazol-1-yl)aniline dihydrochloride

CAS: 1431964-05-4

Versatile small molecule scaffold

Formula: C₉H₁₀Cl₂FN₃

Purity: Min. 95%

Molecular weight: 250.1 g/mol

Ref: 3D-GHC96405