CAS 1431964-25-8

1H-Pyrazol-4-amine, 1-methyl-3-phenoxy-, hydrochloride (1:1)

Description:

1H-Pyrazol-4-amine, 1-methyl-3-phenoxy-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a methyl group at the 1-position and a phenoxy group at the 3-position contributes to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit specific pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, which could lead to therapeutic effects. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the hydrochloride moiety. Safety and handling considerations are essential, as with any chemical substance, and proper laboratory protocols should be followed when working with it. Overall, this compound represents a class of heterocyclic amines that may have significant implications in drug development and research.

Formula: C₁₀H₁₁N₃O·ClH

InChI: InChI=1S/C10H11N3O.ClH/c1-13-7-9(11)10(12-13)14-8-5-3-2-4-6-8;/h2-7H,11H2,1H3;1H

InChI key: InChIKey=KAOLAVSZESDTTL-UHFFFAOYSA-N

SMILES: O(C=1C(N)=CN(C)N1)C2=CC=CC=C2.Cl

Synonyms:

• 1H-Pyrazol-4-amine, 1-methyl-3-phenoxy-, hydrochloride (1:1)

1-Methyl-3-phenoxy-1H-pyrazol-4-amine hydrochloride

CAS: 1431964-25-8

Versatile small molecule scaffold

Formula: C₁₀H₁₂ClN₃O

Purity: Min. 95%

Molecular weight: 225.67 g/mol

Ref: 3D-GHC96425