CAS 1431964-57-6

Benzenamine, 2-(2,2-difluoroethoxy)-5-fluoro-, hydrochloride (1:1)

Description:

Benzenamine, 2-(2,2-difluoroethoxy)-5-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with both a difluoroethoxy group and a fluorine atom. The presence of the difluoroethoxy moiety contributes to its unique properties, including potential lipophilicity and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The compound may exhibit biological activity due to the presence of the amine and fluorine substituents, which can influence its interaction with biological targets. Additionally, the fluorine atoms can enhance metabolic stability and alter the compound's pharmacokinetic properties. Safety and handling precautions should be observed, as with any chemical substance, particularly those containing amines and halogens, which may pose health risks. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and materials science.

Formula: C₈H₈F₃NO·ClH

InChI: InChI=1S/C8H8F3NO.ClH/c9-5-1-2-7(6(12)3-5)13-4-8(10)11;/h1-3,8H,4,12H2;1H

InChI key: InChIKey=DGSQVFHHJRIBDO-UHFFFAOYSA-N

SMILES: O(CC(F)F)C1=C(N)C=C(F)C=C1.Cl

Synonyms:

• Benzenamine, 2-(2,2-difluoroethoxy)-5-fluoro-, hydrochloride (1:1)

2-(2,2-Difluoroethoxy)-5-fluoroaniline hydrochloride

CAS: 1431964-57-6

Versatile small molecule scaffold

Formula: C₈H₉ClF₃NO

Purity: Min. 95%

Molecular weight: 227.61 g/mol

Ref: 3D-GHC96457