CAS 1431965-00-2

1H-Pyrazole-5-carboxylic acid, 4-amino-1-methyl-, ethyl ester, hydrochloride (1:1)

Description:

1H-Pyrazole-5-carboxylic acid, 4-amino-1-methyl-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its solubility and reactivity. The presence of an amino group enhances its potential for hydrogen bonding and interaction with biological targets. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The compound's molecular structure suggests potential biological activity, which may include antimicrobial or anti-inflammatory properties, although specific biological effects would require empirical investigation. Its CAS number, 1431965-00-2, allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry and related fields. Overall, this compound represents a versatile scaffold for further chemical modifications and potential therapeutic applications.

Formula: C₇H₁₁N₃O₂·ClH

InChI: InChI=1S/C7H11N3O2.ClH/c1-3-12-7(11)6-5(8)4-9-10(6)2;/h4H,3,8H2,1-2H3;1H

InChI key: InChIKey=BCSLZWZVBUUYOI-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(N)C=NN1C.Cl

Synonyms:

• 1H-Pyrazole-5-carboxylic acid, 4-amino-1-methyl-, ethyl ester, hydrochloride (1:1)

Ethyl 4-amino-1-methyl-1H-pyrazole-5-carboxylate hydrochloride

CAS: 1431965-00-2

Versatile small molecule scaffold

Formula: C₇H₁₂ClN₃O₂

Purity: Min. 95%

Molecular weight: 205.64 g/mol

Ref: 3D-GHC96500