CAS 1431965-01-3

Benzenamine, 4-(2,2-difluoroethoxy)-2-methyl-, hydrochloride (1:1)

Description:

Benzenamine, 4-(2,2-difluoroethoxy)-2-methyl-, hydrochloride (1:1), with the CAS number 1431965-01-3, is a chemical compound characterized by its amine functional group and a substituted aromatic ring. The presence of the difluoroethoxy group indicates that it contains two fluorine atoms attached to an ethoxy moiety, which can influence its reactivity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and organic synthesis. The compound's structure suggests potential biological activity, which may be explored in medicinal chemistry. Its properties, such as melting point, boiling point, and spectral characteristics, would be essential for understanding its behavior in different environments. Additionally, safety data should be reviewed to assess any hazards associated with handling this substance, including toxicity and environmental impact. Overall, this compound represents a unique combination of functional groups that may offer interesting chemical and biological properties.

Formula: C₉H₁₁F₂NO·ClH

InChI: InChI=1S/C9H11F2NO.ClH/c1-6-4-7(2-3-8(6)12)13-5-9(10)11;/h2-4,9H,5,12H2,1H3;1H

InChI key: InChIKey=VREAQECTBMOQLW-UHFFFAOYSA-N

SMILES: O(CC(F)F)C1=CC(C)=C(N)C=C1.Cl

Synonyms:

• Benzenamine, 4-(2,2-difluoroethoxy)-2-methyl-, hydrochloride (1:1)

4-(2,2-Difluoroethoxy)-2-methylaniline hydrochloride

CAS: 1431965-01-3

4-(2,2-Difluoroethoxy)-2-methylaniline hydrochloride

Purity: ≥95%

Molecular weight: 223.65g/mol

Ref: 54-PC410075

4-(2,2-Difluoroethoxy)-2-methylaniline hydrochloride

CAS: 1431965-01-3

Versatile small molecule scaffold

Formula: C₉H₁₂ClF₂NO

Purity: Min. 95%

Molecular weight: 223.65 g/mol

Ref: 3D-GHC96501