CAS 1431965-57-9

Benzenamine, 3-(difluoromethoxy)-, hydrochloride (1:1)

Description:

Benzenamine, 3-(difluoromethoxy)-, hydrochloride (1:1) is a chemical compound characterized by the presence of a benzene ring substituted with an amino group and a difluoromethoxy group. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which enhances its solubility in water and may influence its stability and reactivity. This compound typically exhibits properties associated with both aromatic amines and ether functionalities, including potential applications in pharmaceuticals or agrochemicals. The difluoromethoxy group introduces unique electronic and steric effects, which can affect the compound's reactivity and interaction with biological targets. As a hydrochloride salt, it is likely to be more stable and easier to handle compared to its free base form. Safety data should be consulted for handling and toxicity information, as aromatic amines can pose health risks. Overall, this compound's unique structure and properties make it of interest in various chemical research and development contexts.

Formula: C₇H₇F₂NO·ClH

InChI: InChI=1S/C7H7F2NO.ClH/c8-7(9)11-6-3-1-2-5(10)4-6;/h1-4,7H,10H2;1H

InChI key: InChIKey=UVJQYOWEOMPURP-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=CC(N)=CC=C1.Cl

Synonyms:

• Benzenamine, 3-(difluoromethoxy)-, hydrochloride (1:1)

3-(Difluoromethoxy)aniline hydrochloride

CAS: 1431965-57-9

3-(Difluoromethoxy)aniline hydrochloride

Formula: C₇H₇F₂NO·ClH

Purity: ≥95%

Color and Shape: cream powder

Molecular weight: 195.59432g/mol

Ref: 54-PC411307