CAS 1431965-79-5

Benzenamine, 3-[(2-chlorophenoxy)methyl]-, hydrochloride (1:1)

Description:

Benzenamine, 3-[(2-chlorophenoxy)methyl]-, hydrochloride (1:1), also known as a specific type of substituted aniline, is characterized by its amine functional group attached to a benzene ring, which is further substituted with a chlorophenoxy group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The chlorophenoxy moiety contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of the hydrochloride indicates that it is a salt formed from the reaction of the amine with hydrochloric acid, which can influence its stability and reactivity. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions. Safety data should be consulted for handling, as compounds with halogenated groups can exhibit toxicity or environmental concerns.

Formula: C₁₃H₁₂ClNO·ClH

InChI: InChI=1S/C13H12ClNO.ClH/c14-12-6-1-2-7-13(12)16-9-10-4-3-5-11(15)8-10;/h1-8H,9,15H2;1H

InChI key: InChIKey=YKBDQMLXMFGOMM-UHFFFAOYSA-N

SMILES: O(CC1=CC(N)=CC=C1)C2=C(Cl)C=CC=C2.Cl

Synonyms:

• Benzenamine, 3-[(2-chlorophenoxy)methyl]-, hydrochloride (1:1)

3-[(2-Chlorophenoxy)methyl]aniline hydrochloride

CAS: 1431965-79-5

Versatile small molecule scaffold

Formula: C₁₃H₁₃Cl₂NO

Purity: Min. 95%

Molecular weight: 270.15 g/mol

Ref: 3D-GHC96579