CAS 1431966-50-5

1H-Pyrazole-1-propanoic acid, 4-amino-, hydrochloride (1:1)

Description:

1H-Pyrazole-1-propanoic acid, 4-amino-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a propanoic acid moiety and an amino group at the 4-position of the pyrazole ring, contributing to its potential biological activity. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The presence of the amino group suggests potential interactions with biological targets, which may be relevant in medicinal chemistry. This compound may exhibit properties such as acidity due to the carboxylic acid group and basicity from the amino group, allowing it to participate in various chemical reactions. Its specific applications and biological activities would depend on further studies and characterization, but it is likely to be of interest in drug development and research settings.

Formula: C₆H₉N₃O₂·ClH

InChI: InChI=1S/C6H9N3O2.ClH/c7-5-3-8-9(4-5)2-1-6(10)11;/h3-4H,1-2,7H2,(H,10,11);1H

InChI key: InChIKey=FEOVEKVIBXTIQZ-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1C=C(N)C=N1.Cl

Synonyms:

• 1H-Pyrazole-1-propanoic acid, 4-amino-, hydrochloride (1:1)

3-(4-Amino-1H-pyrazol-1-yl)propanoic acid hydrochloride

CAS: 1431966-50-5

Versatile small molecule scaffold

Formula: C₆H₁₀ClN₃O₂

Purity: Min. 95%

Molecular weight: 191.61 g/mol

Ref: 3D-GHC96650