CAS 1431966-53-8

3-Isoxazolecarboxylic acid, 4-[(diethylamino)methyl]-5-methyl-, hydrochloride (1:1)

Description:

3-Isoxazolecarboxylic acid, 4-[(diethylamino)methyl]-5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its isoxazole ring structure, which contributes to its unique reactivity and properties. This compound features a carboxylic acid functional group, indicating it can participate in acid-base reactions and form salts. The presence of a diethylamino group enhances its solubility in polar solvents and may influence its biological activity, making it of interest in pharmaceutical applications. The hydrochloride form suggests that it is a salt, which typically improves stability and solubility in aqueous solutions. The methyl group on the isoxazole ring can affect the compound's steric and electronic properties, potentially influencing its interaction with biological targets. Overall, this compound's characteristics, including its molecular structure and functional groups, suggest potential utility in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activities and applications would require further investigation and validation through experimental studies.

Formula: C₁₀H₁₆N₂O₃.ClH

InChI: InChI=1S/C10H16N2O3.ClH/c1-4-12(5-2)6-8-7(3)15-11-9(8)10(13)14;/h4-6H2,1-3H3,(H,13,14);1H

InChI key: InChIKey=PSZDVFGWPYPQAQ-UHFFFAOYSA-N

SMILES: C(N(CC)CC)C=1C(C(O)=O)=NOC1C.Cl

4-[(diethylamino)methyl]-5-methyl-3-isoxazolecarboxylic acid hydrochloride

CAS: 1431966-53-8

Formula: C₁₀H₁₇ClN₂O₃

Purity: 95.0%

Molecular weight: 248.71

Ref: 10-F358600