CymitQuimica logo

CAS 1431966-65-2

:

1H-Pyrazol-4-amine, 1-[(6,7-dihydro-5H-pyrrolo[2,1-c]-1,2,4-triazol-3-yl)methyl]-, hydrochloride (1:1)

Description:
1H-Pyrazol-4-amine, 1-[(6,7-dihydro-5H-pyrrolo[2,1-c]-1,2,4-triazol-3-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a pyrazole and a pyrrolo-triazole moiety. This compound typically appears as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in pharmaceutical research. The presence of the pyrazole ring suggests potential biological activity, as pyrazole derivatives are often investigated for their roles in medicinal chemistry, particularly in the development of anti-inflammatory and anti-cancer agents. The compound's molecular structure may exhibit specific interactions with biological targets, influencing its pharmacological properties. Additionally, the hydrochloride form indicates that it may be more stable and easier to handle in laboratory settings. As with many such compounds, safety data and handling precautions are essential due to potential toxicity or reactivity. Overall, this compound represents a significant interest in the field of drug discovery and development.
Formula:C9H12N6·ClH
InChI:InChI=1S/C9H12N6.ClH/c10-7-4-11-14(5-7)6-9-13-12-8-2-1-3-15(8)9;/h4-5H,1-3,6,10H2;1H
InChI key:InChIKey=NQPSGILSQXRCQB-UHFFFAOYSA-N
SMILES:C(C=1N2C(=NN1)CCC2)N3C=C(N)C=N3.Cl
Synonyms:
  • 1H-Pyrazol-4-amine, 1-[(6,7-dihydro-5H-pyrrolo[2,1-c]-1,2,4-triazol-3-yl)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.