CAS 1431967-81-5

1H-Pyrazol-4-amine, 3-(4-chloro-3-fluorophenoxy)-1-methyl-, hydrochloride (1:1)

Description:

1H-Pyrazol-4-amine, 3-(4-chloro-3-fluorophenoxy)-1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of the 4-amino group on the pyrazole ring contributes to its potential reactivity and biological activity. The compound features a 3-(4-chloro-3-fluorophenoxy) substituent, indicating the presence of a phenoxy group that is further substituted with chlorine and fluorine atoms, which can influence its pharmacological properties and lipophilicity. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific interactions and mechanisms of action would depend on the structural characteristics and the functional groups present, which can affect its binding affinity to biological targets. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₀H₉ClFN₃O·ClH

InChI: InChI=1S/C10H9ClFN3O.ClH/c1-15-5-9(13)10(14-15)16-6-2-3-7(11)8(12)4-6;/h2-5H,13H2,1H3;1H

InChI key: InChIKey=JIYUHJHMKVROOJ-UHFFFAOYSA-N

SMILES: O(C1=NN(C)C=C1N)C2=CC(F)=C(Cl)C=C2.Cl

Synonyms:

• 1H-Pyrazol-4-amine, 3-(4-chloro-3-fluorophenoxy)-1-methyl-, hydrochloride (1:1)

3-(4-Chloro-3-fluorophenoxy)-1-methyl-1H-pyrazol-4-amine hydrochloride

CAS: 1431967-81-5

Versatile small molecule scaffold

Formula: C₁₀H₁₀Cl₂FN₃O

Purity: Min. 95%

Molecular weight: 278.11 g/mol

Ref: 3D-GHC96781