CAS 1431967-87-1

Benzenamine, 3-fluoro-4-(3-pyridinylmethoxy)-, hydrochloride (1:1)

Description:

Benzenamine, 3-fluoro-4-(3-pyridinylmethoxy)-, hydrochloride (1:1), also known by its CAS number 1431967-87-1, is a chemical compound characterized by its complex structure that includes a benzenamine core substituted with a fluorine atom and a pyridinylmethoxy group. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceutical contexts. The presence of the fluorine atom can influence the compound's electronic properties and biological activity, while the pyridinylmethoxy moiety may contribute to its interaction with biological targets. As a hydrochloride, it is likely to be a white or off-white crystalline solid. The compound's characteristics, such as melting point, solubility, and stability, are influenced by its molecular structure and the presence of the hydrochloride group. Overall, this compound may exhibit potential as a therapeutic agent, although specific biological activities and mechanisms would require further investigation.

Formula: C₁₂H₁₁FN₂O·ClH

InChI: InChI=1S/C12H11FN2O.ClH/c13-11-6-10(14)3-4-12(11)16-8-9-2-1-5-15-7-9;/h1-7H,8,14H2;1H

InChI key: InChIKey=JJOINMYDSTWKFV-UHFFFAOYSA-N

SMILES: O(CC=1C=CC=NC1)C2=C(F)C=C(N)C=C2.Cl

Synonyms:

• Benzenamine, 3-fluoro-4-(3-pyridinylmethoxy)-, hydrochloride (1:1)

3-Fluoro-4-[(pyridin-3-yl)methoxy]aniline hydrochloride

CAS: 1431967-87-1

Versatile small molecule scaffold

Formula: C₁₂H₁₂ClFN₂O

Purity: Min. 95%

Molecular weight: 254.69 g/mol

Ref: 3D-GHC96787