CAS 1432029-11-2

Benzenamine, 5-fluoro-2-(4-methyl-1H-pyrazol-1-yl)-, hydrochloride (1:1)

Description:

Benzenamine, 5-fluoro-2-(4-methyl-1H-pyrazol-1-yl)-, hydrochloride (1:1) is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a fluorine atom and a pyrazole moiety. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water. This compound typically exhibits properties associated with both amines and heterocyclic compounds, such as moderate to high polarity and potential biological activity. The fluorine substitution can influence its reactivity and pharmacological properties, making it of interest in medicinal chemistry. Additionally, the pyrazole ring may contribute to its potential as a ligand in various chemical reactions or as a pharmacophore in drug development. Safety data should be consulted for handling and exposure risks, as with any chemical substance, particularly those with amine functionalities, which can be toxic or irritative.

Formula: C₁₀H₁₀FN₃·ClH

InChI: InChI=1S/C10H10FN3.ClH/c1-7-5-13-14(6-7)10-3-2-8(11)4-9(10)12;/h2-6H,12H2,1H3;1H

InChI key: InChIKey=GGZBWQGIOUGZBJ-UHFFFAOYSA-N

SMILES: NC1=C(C=CC(F)=C1)N2C=C(C)C=N2.Cl

Synonyms:

• Benzenamine, 5-fluoro-2-(4-methyl-1H-pyrazol-1-yl)-, hydrochloride (1:1)

5-Fluoro-2-(4-methyl-1H-pyrazol-1-yl)aniline hydrochloride

CAS: 1432029-11-2

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClFN₃

Purity: Min. 95%

Molecular weight: 227.66 g/mol

Ref: 3D-HHC02911