CAS 143205-42-9: (melle-4)cyclosporin
Description:Melle-4-cyclosporin, identified by the CAS number 143205-42-9, is a derivative of cyclosporin, a cyclic peptide known for its immunosuppressive properties. This compound is characterized by its complex structure, which includes multiple amino acid residues forming a cyclic arrangement. Melle-4-cyclosporin exhibits a high degree of lipophilicity, allowing it to easily penetrate cell membranes and interact with intracellular targets. Its primary application lies in the field of medicine, particularly in organ transplantation and autoimmune diseases, where it helps to prevent organ rejection by inhibiting T-cell activation and proliferation. The compound's mechanism of action involves binding to cyclophilin, a protein that modulates calcineurin activity, ultimately leading to decreased production of interleukin-2 and other cytokines. Additionally, melle-4-cyclosporin may have distinct pharmacokinetic properties compared to other cyclosporin variants, influencing its efficacy and safety profile. As with other immunosuppressants, careful monitoring of therapeutic levels and potential side effects is essential during treatment.
Formula:C62H111N11O12
InChI:InChI=1/C62H111N11O12/c1-25-28-29-40(15)52(75)51-56(79)65-43(27-3)58(81)67(18)33-47(74)71(22)50(39(14)26-2)55(78)66-48(37(10)11)61(84)68(19)44(30-34(4)5)54(77)63-41(16)53(76)64-42(17)57(80)69(20)45(31-35(6)7)59(82)70(21)46(32-36(8)9)60(83)72(23)49(38(12)13)62(85)73(51)24/h25,28,34-46,48-52,75H,26-27,29-33H2,1-24H3,(H,63,77)(H,64,76)(H,65,79)(H,66,78)/b28-25+
- Synonyms:
- Sdz nim 811
- 9-(N-Methyl-L-isoleucine)cyclosporin A
- Nim 811
- Nim811
- Sdz nim811
- Cyclosporin A, 9-(N-methyl-L-isoleucine)-
- 30-ethyl-33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-3,21-bis(1-methylethyl)-24-(1-methylpropyl)-6,9,18-tris(2-methylpropyl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | NIM811 REF: TM-T12226CAS: 143205-42-9 | 98% | To inquire | Mon 05 May 25 |
![]() | NIM811 REF: 3D-TFA20542CAS: 143205-42-9 | Min. 95% | To inquire | Tue 17 Jun 25 |

NIM811
Ref: TM-T12226
5mg | To inquire |

NIM811
Ref: 3D-TFA20542
5mg | 1,912.00 € | ||
10mg | 2,979.00 € | ||
25mg | 5,585.00 € | ||
50mg | 8,936.00 € |