CAS 143205-42-9
:(melle-4)cyclosporin
Description:
Melle-4-cyclosporin, identified by the CAS number 143205-42-9, is a derivative of cyclosporin, a cyclic peptide known for its immunosuppressive properties. This compound is characterized by its complex structure, which includes multiple amino acid residues forming a cyclic arrangement. Melle-4-cyclosporin exhibits a high degree of lipophilicity, allowing it to easily penetrate cell membranes and interact with intracellular targets. Its primary application lies in the field of medicine, particularly in organ transplantation and autoimmune diseases, where it helps to prevent organ rejection by inhibiting T-cell activation and proliferation. The compound's mechanism of action involves binding to cyclophilin, a protein that modulates calcineurin activity, ultimately leading to decreased production of interleukin-2 and other cytokines. Additionally, melle-4-cyclosporin may have distinct pharmacokinetic properties compared to other cyclosporin variants, influencing its efficacy and safety profile. As with other immunosuppressants, careful monitoring of therapeutic levels and potential side effects is essential during treatment.
Formula:C62H111N11O12
InChI:InChI=1/C62H111N11O12/c1-25-28-29-40(15)52(75)51-56(79)65-43(27-3)58(81)67(18)33-47(74)71(22)50(39(14)26-2)55(78)66-48(37(10)11)61(84)68(19)44(30-34(4)5)54(77)63-41(16)53(76)64-42(17)57(80)69(20)45(31-35(6)7)59(82)70(21)46(32-36(8)9)60(83)72(23)49(38(12)13)62(85)73(51)24/h25,28,34-46,48-52,75H,26-27,29-33H2,1-24H3,(H,63,77)(H,64,76)(H,65,79)(H,66,78)/b28-25+
Synonyms:- Sdz nim 811
- 9-(N-Methyl-L-isoleucine)cyclosporin A
- Nim 811
- Nim811
- Sdz nim811
- Cyclosporin A, 9-(N-methyl-L-isoleucine)-
- 30-ethyl-33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-3,21-bis(1-methylethyl)-24-(1-methylpropyl)-6,9,18-tris(2-methylpropyl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
NIM811
CAS:<p>NIM811 is an orally bioavailable dual inhibitor of mitochondrial permeability transition and cyclophilin.</p>Formula:C62H111N11O12Purity:98%Color and Shape:SolidMolecular weight:1202.635NIM811
CAS:<p>NIM811 is an antimicrobial agent that inhibits the growth of a wide range of bacteria by binding to the bacterial ribosome. NIM811 has been shown to be active against resistant mutants and neuronal death in vitro. NIM811 was also shown to protect against mitochondrial membrane potential collapse and to maintain intracellular ATP levels in vivo human cells. The mechanism of action for NIM811 may be due to its ability to inhibit Toll-like receptor signaling, which can lead to the activation of the immune system. This drug has been shown to have synergistic effects when used in combination therapy with other drugs, such as active antiretroviral therapy.</p>Formula:C62H111N11O12Purity:Min. 95%Molecular weight:1,202.6 g/mol

