CAS 1432053-86-5

Methyl 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]benzoate

Description:

Methyl 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]benzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety and a pyridine ring substituted with chlorine and trifluoromethyl groups. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The chlorine atom contributes to the compound's reactivity and can affect its solubility in different solvents. Methyl 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]benzoate may be utilized in various applications, including pharmaceuticals, agrochemicals, and materials science, due to its unique electronic and steric properties. Safety and handling considerations are essential, as with many halogenated compounds, due to potential toxicity and environmental impact.

Formula: C₁₄H₉ClF₃NO₂

InChI: InChI=1S/C14H9ClF3NO2/c1-21-13(20)9-4-2-8(3-5-9)11-6-10(14(16,17)18)7-12(15)19-11/h2-7H,1H3

InChI key: InChIKey=NDTSEQBEAGTZSU-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(N=C(Cl)C1)C2=CC=C(C(OC)=O)C=C2

Synonyms:

• Methyl 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]benzoate
• Benzoic acid, 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-, methyl ester

Methyl 4-[2-chloro-4-(trifluoromethyl)pyridin-6-yl]benzoate

CAS: 1432053-86-5

Methyl 4-[2-chloro-4-(trifluoromethyl)pyridin-6-yl]benzoate

Purity: ≥95%

Molecular weight: 315.67g/mol

Ref: 54-PC400683