CAS 1432053-94-5

Ethyl 5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxylate

Description:

Ethyl 5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxylate is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The ethyl ester functional group contributes to its solubility properties and reactivity, allowing for potential applications in organic synthesis and medicinal chemistry. This compound may exhibit various biological activities, including antimicrobial or anti-inflammatory properties, due to the structural features of the oxadiazole and the trifluoromethyl substitution. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further investigation in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups, which may pose environmental and health risks.

Formula: C₁₂H₉F₃N₂O₃

InChI: InChI=1S/C12H9F3N2O3/c1-2-19-11(18)10-17-16-9(20-10)7-4-3-5-8(6-7)12(13,14)15/h3-6H,2H2,1H3

InChI key: InChIKey=DMZCUMSFWKUUCE-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1OC(=NN1)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• Ethyl 5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxylate
• 1,3,4-Oxadiazole-2-carboxylic acid, 5-[3-(trifluoromethyl)phenyl]-, ethyl ester

Ethyl 5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxylate

CAS: 1432053-94-5

Ethyl 5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxylate

Purity: 95%

Molecular weight: 286.21g/mol

Ref: 54-PC400667