CAS 1432053-99-0

Piperazine, 1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-4-methyl-, hydrochloride (1:1)

Description:

Piperazine, 1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a 5-bromo and a trifluoromethyl group on the pyridine ring contributes to its unique properties, including increased lipophilicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could lead to applications in treating various conditions. Safety and handling precautions are essential, as with any chemical, due to the presence of halogenated groups that may pose environmental and health risks. Overall, this compound represents a class of piperazine derivatives that are valuable in research and drug development.

Formula: C₁₁H₁₃BrF₃N₃·ClH

InChI: InChI=1S/C11H13BrF3N3.ClH/c1-17-2-4-18(5-3-17)10-9(11(13,14)15)6-8(12)7-16-10;/h6-7H,2-5H2,1H3;1H

InChI key: InChIKey=IDVQKDKGZZNBKL-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(N=CC(Br)=C1)N2CCN(C)CC2.Cl

Synonyms:

• Piperazine, 1-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-4-methyl-, hydrochloride (1:1)