CAS 14322-82-8
:Benzoic acid, dimer
Description:
Benzoic acid dimer, with the CAS number 14322-82-8, is a molecular compound formed by the dimerization of benzoic acid molecules through hydrogen bonding. This substance typically exhibits a solid state at room temperature and is characterized by its white crystalline appearance. The dimerization process enhances the stability of the benzoic acid molecules, influencing their solubility and melting point compared to the monomeric form. Benzoic acid dimer is known for its relatively low volatility and is less soluble in water than its monomer counterpart, reflecting the impact of intermolecular interactions. The compound retains the functional carboxylic acid group, which can participate in various chemical reactions, including esterification and acid-base reactions. Its applications may extend to the fields of organic synthesis and materials science, where it can serve as a building block or a model compound for studying hydrogen bonding and molecular interactions. Overall, benzoic acid dimer is an interesting subject of study due to its unique structural and chemical properties.
Formula:(C7H6O2)2
InChI:InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)
InChI key:InChIKey=WPYMKLBDIGXBTP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=CC=C1
Synonyms:- Benzoic acid, dimer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
