CAS 14324-83-5
:nickel trifluoroacetylacetonate
Description:
Nickel trifluoroacetylacetonate, with the CAS number 14324-83-5, is a coordination compound of nickel that features trifluoroacetylacetonate ligands. This compound typically appears as a green or blue-green solid and is soluble in organic solvents such as acetone and ethanol. It is characterized by its coordination geometry, which often exhibits a square planar or octahedral arrangement around the nickel center, depending on the specific conditions and the presence of other ligands. Nickel trifluoroacetylacetonate is known for its applications in various fields, including catalysis, materials science, and as a precursor in the synthesis of nickel-containing materials. The trifluoroacetylacetonate ligands contribute to the compound's stability and reactivity, making it useful in organic synthesis and coordination chemistry. Additionally, it is important to handle this compound with care, as it may pose health risks if ingested or inhaled, and appropriate safety measures should be observed during its use.
Formula:C10H12F6NiO6
InChI:InChI=1/2C5H5F3O2.Ni.2H2O/c2*1-3(9)2-4(10)5(6,7)8;;;/h2*2,10H,1H3;;2*1H2/q;;+2;;/p-2/b2*4-2-;;;
Synonyms:- Nickel trifluoropentanedionate
- 1,1,1-Trifluoropentane-2,4-Dione - Nickel (2:1)
- nickel(2+) bis[(2Z)-1,1,1-trifluoro-4-oxopent-2-en-2-olate] dihydrate
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Nickel(II) trifluoroacetylacetonate dihydrate, 98%
CAS:Nickel(II) trifluoroacetylacetonate dihydrate, 98%
Formula:Ni(CF3COCHCOCH3)2·2H2OPurity:98%Color and Shape:green pwdr.Molecular weight:364.87 (400.90)Nickel(II) trifluoroacetylacetonate dihydrate
CAS:Nickel(II) trifluoroacetylacetonate dihydrateFormula:·2C5H4F3O2·Ni·2H2OPurity:95% Contains 5%H2OMolecular weight:400.88248Nickel1,1,1-trifluoro2,4-pentanedionate
CAS:Formula:C10H8F6NiO4Purity:98%Color and Shape:SolidMolecular weight:364.8519Nickel1,1,1-trifluoro2,4-pentanedionate
CAS:Nickel1,1,1-trifluoro2,4-pentanedionateFormula:C10H8F6NiO4Purity:95% Contains 5%H2OMolecular weight:364.85Nickel trifluoroacetylacetonate, dihydrate
CAS:Formula:C10H8F6NiO4Purity:97.0%Color and Shape:SolidMolecular weight:364.854




