
CAS 1432501-10-4
:(3R)-2,3-Dihydro-3-hydroxy-5,6,7-trimethoxy-3-[(4-methoxyphenyl)methyl]-4H-1-benzopyran-4-one
Description:
(3R)-2,3-Dihydro-3-hydroxy-5,6,7-trimethoxy-3-[(4-methoxyphenyl)methyl]-4H-1-benzopyran-4-one is a complex organic compound characterized by its benzopyran structure, which is a fused ring system consisting of a benzene ring and a pyran ring. This compound features multiple methoxy groups, which are known to enhance solubility and influence biological activity. The presence of a hydroxyl group contributes to its potential reactivity and ability to form hydrogen bonds, while the (3R) configuration indicates specific stereochemistry that can affect its interaction with biological targets. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique arrangement of functional groups that may exhibit antioxidant, anti-inflammatory, or other therapeutic properties. Additionally, the methoxyphenylmethyl substituent may enhance lipophilicity, influencing its pharmacokinetics. Overall, this compound represents a class of bioactive molecules that warrant further investigation for their potential health benefits.
Formula:C20H22O7
InChI:InChI=1S/C20H22O7/c1-23-13-7-5-12(6-8-13)10-20(22)11-27-14-9-15(24-2)17(25-3)18(26-4)16(14)19(20)21/h5-9,22H,10-11H2,1-4H3/t20-/m1/s1
InChI key:InChIKey=XPJYOBQMHUPHPG-HXUWFJFHSA-N
SMILES:O(C)C1=C2C(=CC(OC)=C1OC)OC[C@@](CC3=CC=C(OC)C=C3)(O)C2=O
Synonyms:- (3R)-2,3-Dihydro-3-hydroxy-5,6,7-trimethoxy-3-[(4-methoxyphenyl)methyl]-4H-1-benzopyran-4-one
- Urgineanin A
- (3R)-3-Hydroxy-3-(4′-methoxybenzyl)-5,6,7-trimethoxychroman-4-one
- 4′-O-Methylurgineanin B
- 4H-1-Benzopyran-4-one, 2,3-dihydro-3-hydroxy-5,6,7-trimethoxy-3-[(4-methoxyphenyl)methyl]-, (3R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Urgineanin A
CAS:Urgineanin A is a useful organic compound for research related to life sciences. The catalog number is T125870 and the CAS number is 1432501-10-4.Formula:C20H22O7Color and Shape:SolidMolecular weight:374.389
