CAS 1432677-67-2

1H-Pyrazole-4-propanoic acid, α-(aminomethyl)-1-methyl-, hydrochloride (1:1)

Description:

1H-Pyrazole-4-propanoic acid, α-(aminomethyl)-1-methyl-, hydrochloride (1:1), with CAS number 1432677-67-2, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a propanoic acid moiety and an aminomethyl group, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the methyl group on the pyrazole ring may influence its pharmacokinetic properties, such as absorption and metabolism. This compound is of interest in medicinal chemistry, particularly for its potential therapeutic effects, which may include anti-inflammatory or analgesic properties. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₈H₁₃N₃O₂·ClH

InChI: InChI=1S/C8H13N3O2.ClH/c1-11-5-6(4-10-11)2-7(3-9)8(12)13;/h4-5,7H,2-3,9H2,1H3,(H,12,13);1H

InChI key: InChIKey=FEZVMHZHJKEMNH-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)CN)C1=CN(C)N=C1.Cl

Synonyms:

• 1H-Pyrazole-4-propanoic acid, α-(aminomethyl)-1-methyl-, hydrochloride (1:1)

3-Amino-2-[(1-methyl-1H-pyrazol-4-yl)methyl]propanoic acid hydrochloride

CAS: 1432677-67-2

Versatile small molecule scaffold

Formula: C₈H₁₄ClN₃O₂

Purity: Min. 95%

Molecular weight: 219.67 g/mol

Ref: 3D-HHC67767