CAS 1432678-10-8

1H-Pyrrole, 2,5-dihydro-3-(3-methoxyphenyl)-, hydrochloride (1:1)

Description:

1H-Pyrrole, 2,5-dihydro-3-(3-methoxyphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This specific compound features a methoxyphenyl substituent at the 3-position of the pyrrole, contributing to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the methoxy group may influence its electronic properties and reactivity, making it of interest in medicinal chemistry. The compound's CAS number, 1432678-10-8, allows for precise identification and retrieval of information in chemical databases. Overall, this substance may exhibit interesting pharmacological properties, warranting further investigation in drug development and related fields.

Formula: C₁₁H₁₃NO·ClH

InChI: InChI=1S/C11H13NO.ClH/c1-13-11-4-2-3-9(7-11)10-5-6-12-8-10;/h2-5,7,12H,6,8H2,1H3;1H

InChI key: InChIKey=HKQBCFQRQYTBSQ-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=CC1)C2=CCNC2.Cl

Synonyms:

• 1H-Pyrrole, 2,5-dihydro-3-(3-methoxyphenyl)-, hydrochloride (1:1)

3-(3-Methoxyphenyl)-2,5-dihydro-1H-pyrrole hydrochloride

CAS: 1432678-10-8

Versatile small molecule scaffold

Formula: C₁₁H₁₄ClNO

Purity: Min. 95%

Molecular weight: 211.69 g/mol

Ref: 3D-HHC67810