CAS 1432678-69-7

Benzenamine, 3-(difluoromethyl)-4-(methylsulfonyl)-, hydrochloride (1:1)

Description:

Benzenamine, 3-(difluoromethyl)-4-(methylsulfonyl)-, hydrochloride (1:1) is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a difluoromethyl group and a methylsulfonyl group. The presence of the difluoromethyl group imparts unique electronic and steric properties, potentially influencing its reactivity and interactions. The methylsulfonyl group contributes to the compound's solubility and polarity, making it suitable for various applications in medicinal chemistry and material science. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, facilitating its use in pharmaceutical formulations. The compound's CAS number, 1432678-69-7, allows for precise identification in chemical databases. Overall, this substance may exhibit interesting biological activities, making it a candidate for further research in drug development or other chemical applications. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with amine compounds.

Formula: C₈H₉F₂NO₂S.ClH

InChI: InChI=1S/C8H9F2NO2S.ClH/c1-14(12,13)7-3-2-5(11)4-6(7)8(9)10;/h2-4,8H,11H2,1H3;1H

InChI key: InChIKey=PUHLFMAJQACXFX-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C(S(C)(=O)=O)C=CC(N)=C1.Cl

3-(Difluoromethyl)-4-methanesulfonylaniline hydrochloride

CAS: 1432678-69-7

Versatile small molecule scaffold

Formula: C₈H₁₀ClF₂NO₂S

Purity: Min. 95%

Molecular weight: 257.69 g/mol

Ref: 3D-HHC67869