CAS 1432678-93-7

3,5-Bis(difluoromethoxy)benzoic acid

Description:

3,5-Bis(difluoromethoxy)benzoic acid is an aromatic carboxylic acid characterized by the presence of two difluoromethoxy groups attached to a benzene ring at the 3 and 5 positions. This compound features a carboxylic acid functional group (-COOH), which imparts acidic properties and enhances its solubility in polar solvents. The difluoromethoxy substituents contribute to the compound's unique electronic properties, potentially influencing its reactivity and interactions in various chemical environments. The presence of fluorine atoms typically enhances lipophilicity and can affect the compound's biological activity. Additionally, the molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, where such substituents may play a role in modulating biological activity or physical properties. The compound's stability, solubility, and reactivity can be influenced by the steric and electronic effects of the difluoromethoxy groups, making it a subject of interest in synthetic chemistry and material development.

Formula: C₉H₆F₄O₄

InChI: InChI=1S/C9H6F4O4/c10-8(11)16-5-1-4(7(14)15)2-6(3-5)17-9(12)13/h1-3,8-9H,(H,14,15)

InChI key: InChIKey=JLSSNDJBOJLEOV-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=CC(C(O)=O)=CC(OC(F)F)=C1

Synonyms:

• Benzoic acid, 3,5-bis(difluoromethoxy)-
• 3,5-Bis(difluoromethoxy)benzoic acid

3,5-Bis(difluoromethoxy)benzoic Acid

Controlled Product

CAS: 1432678-93-7

Formula: C₉H₆F₄O₄

Color and Shape: Neat

Molecular weight: 254.135

Ref: TR-D354965

3,5-Bis(difluoromethoxy)benzoic acid

CAS: 1432678-93-7

Versatile small molecule scaffold

Formula: C₉H₆F₄O₄

Purity: Min. 95%

Molecular weight: 254.13 g/mol

Ref: 3D-HHC67893