CAS 1432679-08-7

4-Piperidinamine, 1-[(2-methylpropyl)sulfonyl]-, hydrochloride (1:1)

Description:

4-Piperidinamine, 1-[(2-methylpropyl)sulfonyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a sulfonyl group attached to a branched alkyl chain (specifically 2-methylpropyl) contributes to its unique properties, including potential solubility in polar solvents. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could be explored in medicinal chemistry. Safety and handling precautions are essential, as with any chemical substance, due to potential toxicity or reactivity. Overall, 4-Piperidinamine, 1-[(2-methylpropyl)sulfonyl]-, hydrochloride is a compound that may have applications in various fields, including drug development and chemical synthesis.

Formula: C₉H₂₀N₂O₂S·ClH

InChI: InChI=1S/C9H20N2O2S.ClH/c1-8(2)7-14(12,13)11-5-3-9(10)4-6-11;/h8-9H,3-7,10H2,1-2H3;1H

InChI key: InChIKey=DBOAWZFNNLBTAI-UHFFFAOYSA-N

SMILES: S(CC(C)C)(=O)(=O)N1CCC(N)CC1.Cl

Synonyms:

• 1-(2-Methylpropanesulfonyl)piperidin-4-amine hydrochloride
• 4-Piperidinamine, 1-[(2-methylpropyl)sulfonyl]-, hydrochloride (1:1)

1-(2-Methylpropanesulfonyl)piperidin-4-amine hydrochloride

CAS: 1432679-08-7

Versatile small molecule scaffold

Formula: C₉H₂₁ClN₂O₂S

Purity: Min. 95%

Molecular weight: 256.79 g/mol

Ref: 3D-HHC67908