CAS 1432679-11-2

4H-1,2,4-Triazole-3-methanamine, 4-cyclopropyl-5-methyl-, hydrochloride (1:2)

Description:

4H-1,2,4-Triazole-3-methanamine, 4-cyclopropyl-5-methyl-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a methanamine group, contributing to its basicity and potential for forming salts, as indicated by its hydrochloride form. The presence of cyclopropyl and methyl substituents on the triazole ring influences its steric and electronic properties, potentially affecting its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceuticals. The compound may exhibit specific pharmacological properties, which can be attributed to its unique structural features. However, detailed studies would be necessary to elucidate its full range of characteristics, including its reactivity, stability, and potential uses in medicinal chemistry or other fields.

Formula: C₇H₁₂N₄·2ClH

InChI: InChI=1S/C7H12N4.2ClH/c1-5-9-10-7(4-8)11(5)6-2-3-6;;/h6H,2-4,8H2,1H3;2*1H

InChI key: InChIKey=SBOYCGKHAKGMHB-UHFFFAOYSA-N

SMILES: C(N)C=1N(C(C)=NN1)C2CC2.Cl

Synonyms:

• 4H-1,2,4-Triazole-3-methanamine, 4-cyclopropyl-5-methyl-, hydrochloride (1:2)

(4-Cyclopropyl-5-methyl-4H-1,2,4-triazol-3-yl)methanamine dihydrochloride

CAS: 1432679-11-2

Versatile small molecule scaffold

Formula: C₇H₁₄Cl₂N₄

Purity: Min. 95%

Molecular weight: 225.12 g/mol

Ref: 3D-HHC67911