CAS 1432679-34-9

1H-Azepine, 4-(4-fluorophenyl)hexahydro-, hydrochloride (1:1)

Description:

1H-Azepine, 4-(4-fluorophenyl)hexahydro-, hydrochloride (1:1) is a chemical compound characterized by its azepine ring structure, which consists of a seven-membered nitrogen-containing heterocycle. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, which can influence the compound's electronic properties and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit specific pharmacological properties due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the presence of the fluorine atom and the azepine framework. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₂H₁₆FN·ClH

InChI: InChI=1S/C12H16FN.ClH/c13-12-5-3-11(4-6-12)10-2-1-8-14-9-7-10;/h3-6,10,14H,1-2,7-9H2;1H

InChI key: InChIKey=KDRLSUHCFKNZRK-UHFFFAOYSA-N

SMILES: FC1=CC=C(C=C1)C2CCCNCC2.Cl

Synonyms:

• 1H-Azepine, 4-(4-fluorophenyl)hexahydro-, hydrochloride (1:1)

4-(4-Fluorophenyl)azepane hydrochloride

CAS: 1432679-34-9

Versatile small molecule scaffold

Formula: C₁₂H₁₇ClFN

Purity: Min. 95%

Molecular weight: 229.72 g/mol

Ref: 3D-HHC67934