CAS 1432679-40-7

Benzeneethanamine, 3,4,5-trifluoro-, hydrochloride (1:1)

Description:

Benzeneethanamine, 3,4,5-trifluoro-, hydrochloride (1:1) is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with an ethylamine group and three fluorine atoms at the 3, 4, and 5 positions. The presence of fluorine atoms enhances the compound's lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit properties such as being a potential intermediate in organic synthesis or a building block for more complex molecules. Its specific reactivity and interactions can be influenced by the electron-withdrawing nature of the trifluoromethyl groups, which can affect the compound's acidity and nucleophilicity. Safety data and handling precautions should be observed, as with any chemical, particularly those with potential biological activity or toxicity.

Formula: C₈H₈F₃N·ClH

InChI: InChI=1S/C8H8F3N.ClH/c9-6-3-5(1-2-12)4-7(10)8(6)11;/h3-4H,1-2,12H2;1H

InChI key: InChIKey=XZZYPPHVCTXOBA-UHFFFAOYSA-N

SMILES: C(CN)C1=CC(F)=C(F)C(F)=C1.Cl

Synonyms:

• Benzeneethanamine, 3,4,5-trifluoro-, hydrochloride (1:1)

2-(3,4,5-Trifluorophenyl)ethan-1-amine hydrochloride

Controlled Product

CAS: 1432679-40-7

Versatile small molecule scaffold

Formula: C₈H₉ClF₃N

Purity: Min. 95%

Molecular weight: 211.61 g/mol

Ref: 3D-HHC67940