CAS 1432679-71-4

Hexahydro-5H-cyclopenta[b]-1,4-dithiin-5-one

Description:

Hexahydro-5H-cyclopenta[b]-1,4-dithiin-5-one is a heterocyclic compound characterized by a unique bicyclic structure that incorporates sulfur atoms within its ring system. This compound features a five-membered ring containing two sulfur atoms and a carbonyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of sulfur in the ring enhances its chemical properties, making it of interest in various fields, including medicinal chemistry and materials science. Typically, compounds like this may exhibit interesting electronic properties due to the conjugation between the sulfur atoms and the carbonyl group. Additionally, the saturation of the ring structure suggests that it may have distinct stability and reactivity profiles compared to unsaturated analogs. Its specific applications and behavior in chemical reactions would depend on the functional groups present and the overall molecular environment. As with many sulfur-containing compounds, it may also exhibit unique odor characteristics and biological activity, warranting further investigation for potential uses in pharmaceuticals or agrochemicals.

Formula: C₇H₁₀OS₂

InChI: InChI=1S/C7H10OS2/c8-5-1-2-6-7(5)10-4-3-9-6/h6-7H,1-4H2

InChI key: InChIKey=RTWLIAGBLSHCBR-UHFFFAOYSA-N

SMILES: O=C1C2C(SCCS2)CC1

Synonyms:

• Hexahydro-5H-cyclopenta[b]-1,4-dithiin-5-one
• 5H-Cyclopenta[b]-1,4-dithiin-5-one, hexahydro-

Hexahydro-2H-cyclopenta[b][1,4]dithiin-5-one

CAS: 1432679-71-4

Versatile small molecule scaffold

Formula: C₇H₁₀OS₂

Purity: Min. 95%

Molecular weight: 174.3 g/mol

Ref: 3D-HHC67971