CAS 1432679-75-8

Pyrrolidine, 2-(tetrahydro-2H-pyran-4-yl)-, hydrochloride (1:1)

Description:

Pyrrolidine, 2-(tetrahydro-2H-pyran-4-yl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine and tetrahydro-pyran moieties, which contribute to its cyclic structure and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the tetrahydro-pyran ring suggests that this compound may exhibit interesting stereochemical properties and reactivity, making it a candidate for further research in medicinal chemistry. Its molecular structure may influence its pharmacokinetic and pharmacodynamic profiles, potentially affecting absorption, distribution, metabolism, and excretion (ADME) characteristics. Additionally, the compound may interact with biological targets, which could lead to therapeutic effects or side effects, warranting thorough investigation in drug development contexts. Safety and handling considerations are essential, as with any chemical substance, particularly in laboratory settings.

Formula: C₉H₁₇NO·ClH

InChI: InChI=1S/C9H17NO.ClH/c1-2-9(10-5-1)8-3-6-11-7-4-8;/h8-10H,1-7H2;1H

InChI key: InChIKey=VPXLDMDJYDOPQC-UHFFFAOYSA-N

SMILES: C1(CCCN1)C2CCOCC2.Cl

Synonyms:

• Pyrrolidine, 2-(tetrahydro-2H-pyran-4-yl)-, hydrochloride (1:1)

2-(Oxan-4-yl)pyrrolidine hydrochloride

CAS: 1432679-75-8

Purity: 98%

Molecular weight: 191.6999969

Ref: 10-F650716

2-(Oxan-4-yl)pyrrolidine Hydrochloride

Controlled Product

CAS: 1432679-75-8

Formula: C₉H₁₇NO·HCl

Color and Shape: Neat

Molecular weight: 191.698

Ref: TR-E589613

2-(Oxan-4-yl)pyrrolidine hydrochloride

CAS: 1432679-75-8

Versatile small molecule scaffold

Formula: C₉H₁₈ClNO

Purity: Min. 95%

Molecular weight: 191.7 g/mol

Ref: 3D-HHC67975