CAS 1432679-86-1

Benzenemethanamine, α-ethenyl-3-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, α-ethenyl-3-(trifluoromethyl)-, hydrochloride (1:1), with CAS number 1432679-86-1, is a chemical compound characterized by its amine functional group and the presence of a trifluoromethyl group, which significantly influences its chemical properties and reactivity. This compound typically appears as a white to off-white solid and is soluble in polar solvents, owing to the hydrochloride form that enhances its solubility. The trifluoromethyl group contributes to its lipophilicity and can affect its biological activity, making it of interest in pharmaceutical research. The presence of the ethenyl group suggests potential for polymerization or other reactions typical of alkenes. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. Safety data should be consulted for handling and storage, as compounds with trifluoromethyl groups can exhibit unique toxicological profiles. Overall, this compound's unique structure makes it a subject of interest in various fields, including medicinal chemistry and materials science.

Formula: C₁₀H₁₀F₃N·ClH

InChI: InChI=1S/C10H10F3N.ClH/c1-2-9(14)7-4-3-5-8(6-7)10(11,12)13;/h2-6,9H,1,14H2;1H

InChI key: InChIKey=QLERDLVRZIMGPC-UHFFFAOYSA-N

SMILES: C(C=C)(N)C1=CC(C(F)(F)F)=CC=C1.Cl

Synonyms:

• Benzenemethanamine, α-ethenyl-3-(trifluoromethyl)-, hydrochloride (1:1)

1-[3-(Trifluoromethyl)phenyl]prop-2-en-1-amine hydrochloride

CAS: 1432679-86-1

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClF₃N

Purity: Min. 95%

Molecular weight: 237.65 g/mol

Ref: 3D-HHC67986