CAS 1432679-92-9

1-Piperazinepropanoic acid, 2-methyl-, methyl ester, hydrochloride (1:2)

Description:

1-Piperazinepropanoic acid, 2-methyl-, methyl ester, hydrochloride (1:2) is a chemical compound characterized by its piperazine and propanoic acid moieties, which contribute to its biological activity and potential pharmaceutical applications. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its ionic nature due to the hydrochloride salt form. The presence of the piperazine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its methyl ester functionality may enhance lipophilicity, influencing absorption and distribution in biological systems. The compound's hydrochloride form indicates it is a salt, which can improve stability and solubility. As with many piperazine derivatives, it may exhibit a range of pharmacological activities, including effects on the central nervous system. However, specific biological properties, toxicity, and therapeutic potential would require further investigation through experimental studies and clinical trials.

Formula: C₉H₁₈N₂O₂·2ClH

InChI: InChI=1S/C9H18N2O2.2ClH/c1-8-7-10-4-6-11(8)5-3-9(12)13-2;;/h8,10H,3-7H2,1-2H3;2*1H

InChI key: InChIKey=SWZYPYIVROOPKQ-UHFFFAOYSA-N

SMILES: C(CC(OC)=O)N1C(C)CNCC1.Cl

Synonyms:

• 1-Piperazinepropanoic acid, 2-methyl-, methyl ester, hydrochloride (1:2)

Methyl 3-(2-methylpiperazin-1-yl)propanoate dihydrochloride

CAS: 1432679-92-9

Versatile small molecule scaffold

Formula: C₉H₂₀Cl₂N₂O₂

Purity: Min. 95%

Molecular weight: 259.17 g/mol

Ref: 3D-HHC67992