CAS 1432680-07-3

3-Pyridinamine, 5-methyl-6-(1-piperidinyl)-, hydrochloride (1:2)

Description:

3-Pyridinamine, 5-methyl-6-(1-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the piperidine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as being a potential ligand for various receptors or enzymes, influencing its pharmacological profile. Its molecular structure includes functional groups that may participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would be essential for further characterization and application in research or therapeutic contexts. As with many chemical substances, safety data and handling precautions are crucial for its use in laboratory settings.

Formula: C₁₁H₁₇N₃·2ClH

InChI: InChI=1S/C11H17N3.2ClH/c1-9-7-10(12)8-13-11(9)14-5-3-2-4-6-14;;/h7-8H,2-6,12H2,1H3;2*1H

InChI key: InChIKey=QOGXJPLGKHCZRB-UHFFFAOYSA-N

SMILES: CC1=C(N2CCCCC2)N=CC(N)=C1.Cl

Synonyms:

• 3-Pyridinamine, 5-methyl-6-(1-piperidinyl)-, hydrochloride (1:2)

5-Methyl-6-(piperidin-1-yl)pyridin-3-amine dihydrochloride

CAS: 1432680-07-3

Versatile small molecule scaffold

Formula: C₁₁H₁₉Cl₂N₃

Purity: Min. 95%

Molecular weight: 264.19 g/mol

Ref: 3D-HHC68007