CAS 1432680-22-2

Hydrazine, bicyclo[2.2.1]hept-2-yl-, hydrochloride (1:2)

Description:

Hydrazine, bicyclo[2.2.1]hept-2-yl-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which includes a hydrazine functional group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form. The bicyclo[2.2.1]heptane framework contributes to its unique chemical properties, including potential reactivity and stability under certain conditions. As a hydrazine derivative, it may exhibit properties such as being a reducing agent and having applications in organic synthesis, particularly in the preparation of various nitrogen-containing compounds. Safety considerations are important, as hydrazine and its derivatives can be toxic and potentially hazardous. Proper handling and storage protocols should be followed to mitigate risks associated with exposure. Overall, this compound's structural characteristics and functional groups make it of interest in both industrial and research settings.

Formula: C₇H₁₄N₂·2ClH

InChI: InChI=1S/C7H14N2.2ClH/c8-9-7-4-5-1-2-6(7)3-5;;/h5-7,9H,1-4,8H2;2*1H

InChI key: InChIKey=JFNYBJKQPZBDPL-UHFFFAOYSA-N

SMILES: N(N)C1C2CC(C1)CC2.Cl

Synonyms:

• Hydrazine, bicyclo[2.2.1]hept-2-yl-, hydrochloride (1:2)

{Bicyclo[2.2.1]heptan-2-yl}hydrazine dihydrochloride

CAS: 1432680-22-2

Versatile small molecule scaffold

Formula: C₇H₁₆Cl₂N₂

Purity: Min. 95%

Molecular weight: 199.12 g/mol

Ref: 3D-HHC68022