CAS 1432680-30-2

1,1-Dimethylethyl 4,5-dihydro-α-oxo-3-furanacetate

Description:

1,1-Dimethylethyl 4,5-dihydro-α-oxo-3-furanacetate, identified by its CAS number 1432680-30-2, is an organic compound characterized by its furan ring structure and ester functional group. This compound features a dimethyl group attached to a tertiary carbon, contributing to its steric hindrance and potentially influencing its reactivity and stability. The presence of the α-oxo group indicates that it may participate in various chemical reactions, such as condensation or oxidation. The furan ring, known for its aromatic properties, can also engage in electrophilic substitution reactions. This compound may exhibit moderate polarity due to the ester and carbonyl functionalities, affecting its solubility in polar and non-polar solvents. Additionally, its structural features suggest potential applications in organic synthesis or as an intermediate in the production of more complex molecules. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization.

Formula: C₁₀H₁₄O₄

InChI: InChI=1S/C10H14O4/c1-10(2,3)14-9(12)8(11)7-4-5-13-6-7/h6H,4-5H2,1-3H3

InChI key: InChIKey=VOJNTKDWTDOMJH-UHFFFAOYSA-N

SMILES: C(C(OC(C)(C)C)=O)(=O)C=1CCOC1

Synonyms:

• 3-Furanacetic acid, 4,5-dihydro-α-oxo-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4,5-dihydro-α-oxo-3-furanacetate

tert-Butyl 2-(4,5-dihydrofuran-3-yl)-2-oxoacetate

CAS: 1432680-30-2

Versatile small molecule scaffold

Formula: C₁₀H₁₄O₄

Purity: Min. 95%

Molecular weight: 198.22 g/mol

Ref: 3D-HHC68030