CAS 1432680-34-6

2-Pyrrolidinone, 4-amino-1-(2,6-difluorophenyl)-, hydrochloride (1:1)

Description:

2-Pyrrolidinone, 4-amino-1-(2,6-difluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidinone core, which features an amino group and a difluorophenyl substituent. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, reflecting its polar nature due to the presence of the amino and carbonyl functional groups. The difluorophenyl moiety contributes to its unique electronic properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it exists in a stable form that enhances its solubility and bioavailability. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its structural characteristics suggest potential applications in medicinal chemistry, where modifications to the pyrrolidinone framework could lead to novel therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₁₀F₂N₂O·ClH

InChI: InChI=1S/C10H10F2N2O.ClH/c11-7-2-1-3-8(12)10(7)14-5-6(13)4-9(14)15;/h1-3,6H,4-5,13H2;1H

InChI key: InChIKey=NLJYNMVIGOSXTL-UHFFFAOYSA-N

SMILES: FC1=C(C(F)=CC=C1)N2CC(N)CC2=O.Cl

Synonyms:

• 2-Pyrrolidinone, 4-amino-1-(2,6-difluorophenyl)-, hydrochloride (1:1)

4-Amino-1-(2,6-difluorophenyl)pyrrolidin-2-one hydrochloride

CAS: 1432680-34-6

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClF₂N₂O

Purity: Min. 95%

Molecular weight: 248.66 g/mol

Ref: 3D-HHC68034