CAS 1432680-49-3

α-(4-Fluorophenyl)-1-methyl-1H-pyrazole-3-methanamine

Description:

α-(4-Fluorophenyl)-1-methyl-1H-pyrazole-3-methanamine, identified by its CAS number 1432680-49-3, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, which can influence the compound's electronic properties and biological activity. The methyl group attached to the pyrazole nitrogen contributes to its overall structure and may affect its solubility and reactivity. This compound is of interest in medicinal chemistry, potentially serving as a scaffold for the development of pharmaceuticals, particularly in the context of targeting specific biological pathways. Its unique structural features may confer specific interactions with biological targets, making it a candidate for further research in drug discovery. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally for practical applications.

Formula: C₁₁H₁₂FN₃

InChI: InChI=1S/C11H12FN3/c1-15-7-6-10(14-15)11(13)8-2-4-9(12)5-3-8/h2-7,11H,13H2,1H3

InChI key: InChIKey=RFROTZNQHGIQJF-UHFFFAOYSA-N

SMILES: C(N)(C1=NN(C)C=C1)C2=CC=C(F)C=C2

Synonyms:

• α-(4-Fluorophenyl)-1-methyl-1H-pyrazole-3-methanamine
• 1H-Pyrazole-3-methanamine, α-(4-fluorophenyl)-1-methyl-

(4-Fluorophenyl)(1-methyl-1H-pyrazol-3-yl)methanamine

CAS: 1432680-49-3

Versatile small molecule scaffold

Formula: C₁₁H₁₂FN₃

Purity: Min. 95%

Molecular weight: 205.23 g/mol

Ref: 3D-HHC68049