CAS 1432680-66-4

1H-Pyrazole, 4-(1-hydrazinylethyl)-1-methyl-, hydrochloride (1:3)

Description:

1H-Pyrazole, 4-(1-hydrazinylethyl)-1-methyl-, hydrochloride (1:3) is a chemical compound characterized by its pyrazole core, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a hydrazinyl group at the 4-position of the pyrazole ring indicates potential reactivity, particularly in forming hydrazones or undergoing further derivatization. The methyl group at the 1-position contributes to the compound's overall stability and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and research. The compound's structure suggests potential biological activity, making it of interest in medicinal chemistry. Its CAS number, 1432680-66-4, allows for precise identification in chemical databases. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity.

Formula: C₆H₁₂N₄·3ClH

InChI: InChI=1S/C6H12N4.3ClH/c1-5(9-7)6-3-8-10(2)4-6;;;/h3-5,9H,7H2,1-2H3;3*1H

InChI key: InChIKey=ZIOVHXXCBLWPLY-UHFFFAOYSA-N

SMILES: C(NN)(C)C1=CN(C)N=C1.Cl

Synonyms:

• 1-(1-Methylpyrazol-4-yl)ethylhydrazine trihydrochloride
• 1H-Pyrazole, 4-(1-hydrazinylethyl)-1-methyl-, hydrochloride (1:3)

4-(1-Hydrazinylethyl)-1-methyl-1H-pyrazole trihydrochloride

CAS: 1432680-66-4

Versatile small molecule scaffold

Formula: C₆H₁₅Cl₃N₄

Purity: Min. 95%

Molecular weight: 249.6 g/mol

Ref: 3D-HHC68066