CAS 1432680-81-3

Isoquinoline, 6-bromo-1,2,3,4-tetrahydro-8-methyl-, hydrochloride (1:1)

Description:

Isoquinoline, 6-bromo-1,2,3,4-tetrahydro-8-methyl-, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a bromine atom at the 6-position and a methyl group at the 8-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The tetrahydro configuration indicates that the compound has undergone partial hydrogenation, resulting in a saturated structure that may influence its pharmacological properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its specific interactions and effects would depend on the context of its use and the biological systems involved. As with many halogenated organic compounds, care should be taken regarding its handling and potential environmental impact.

Formula: C₁₀H₁₂BrN·ClH

InChI: InChI=1S/C10H12BrN.ClH/c1-7-4-9(11)5-8-2-3-12-6-10(7)8;/h4-5,12H,2-3,6H2,1H3;1H

InChI key: InChIKey=FLQUMDZJVBCOBB-UHFFFAOYSA-N

SMILES: CC1=C2C(=CC(Br)=C1)CCNC2.Cl

Synonyms:

• 6-Bromo-8-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride
• Isoquinoline, 6-bromo-1,2,3,4-tetrahydro-8-methyl-, hydrochloride (1:1)

6-Bromo-8-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride

CAS: 1432680-81-3

Versatile small molecule scaffold

Formula: C₁₀H₁₃BrClN

Purity: Min. 95%

Molecular weight: 262.57 g/mol

Ref: 3D-HHC68081