
CAS 1432680-89-1
:2,4-Imidazolidinedione, 3-ethyl-5-methyl-5-(3-piperidinyl)-, hydrochloride (1:1)
Description:
2,4-Imidazolidinedione, 3-ethyl-5-methyl-5-(3-piperidinyl)-, hydrochloride (1:1), with CAS number 1432680-89-1, is a chemical compound characterized by its imidazolidinedione core structure, which is a five-membered ring containing two nitrogen atoms and two carbonyl groups. This compound features an ethyl and a methyl group at specific positions on the ring, contributing to its unique properties. The presence of a piperidine moiety enhances its potential biological activity, possibly influencing its pharmacological profile. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its stability, solubility, and reactivity can be influenced by the pH and the presence of other ions in solution. Overall, this compound represents a class of heterocyclic compounds that may have significant implications in drug development and therapeutic applications.
Formula:C11H19N3O2·ClH
InChI:InChI=1S/C11H19N3O2.ClH/c1-3-14-9(15)11(2,13-10(14)16)8-5-4-6-12-7-8;/h8,12H,3-7H2,1-2H3,(H,13,16);1H
InChI key:InChIKey=BWLHZGIQSKDVCF-UHFFFAOYSA-N
SMILES:CC1(C(=O)N(CC)C(=O)N1)C2CCCNC2.Cl
Synonyms:- 2,4-Imidazolidinedione, 3-ethyl-5-methyl-5-(3-piperidinyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.