CAS 1432681-07-6

2-Pyridinecarboximidamide, 4-(methylthio)-, hydrochloride (1:1)

Description:

2-Pyridinecarboximidamide, 4-(methylthio)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a carboximidamide functional group indicates that it has both amine and imine characteristics, contributing to its potential reactivity and biological activity. The methylthio group attached to the fourth position of the pyridine ring enhances its chemical properties, possibly influencing solubility and interaction with biological targets. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and research. The compound may exhibit specific pharmacological activities, although detailed studies would be necessary to elucidate its mechanisms of action and potential therapeutic uses. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₇H₉N₃S·ClH

InChI: InChI=1S/C7H9N3S.ClH/c1-11-5-2-3-10-6(4-5)7(8)9;/h2-4H,1H3,(H3,8,9);1H

InChI key: InChIKey=RLSJQANMEQVWDI-UHFFFAOYSA-N

SMILES: C(=N)(N)C1=CC(SC)=CC=N1.Cl

Synonyms:

• 2-Pyridinecarboximidamide, 4-(methylthio)-, hydrochloride (1:1)

4-(Methylsulfanyl)pyridine-2-carboximidamide hydrochloride

CAS: 1432681-07-6

Versatile small molecule scaffold

Formula: C₇H₁₀ClN₃S

Purity: Min. 95%

Molecular weight: 203.69 g/mol

Ref: 3D-HHC68107