CAS 1432681-28-1

1H-Isoindol-4-amine, 2-cyclopropyl-2,3-dihydro-, hydrochloride (1:2)

Description:

1H-Isoindol-4-amine, 2-cyclopropyl-2,3-dihydro-, hydrochloride (1:2) is a chemical compound characterized by its isoindole structure, which features a bicyclic system consisting of a benzene ring fused to a five-membered nitrogen-containing ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form salts with acids, as indicated by its hydrochloride form. The presence of the cyclopropyl group contributes to its unique steric and electronic properties, potentially influencing its reactivity and biological activity. The hydrochloride salt form enhances its solubility in water, making it more amenable for various applications, including pharmaceutical research. The compound may exhibit specific pharmacological activities, although detailed biological data would be necessary to elucidate its mechanisms of action. Overall, its structural features suggest potential utility in medicinal chemistry, particularly in the development of novel therapeutic agents.

Formula: C₁₁H₁₄N₂·2ClH

InChI: InChI=1S/C11H14N2.2ClH/c12-11-3-1-2-8-6-13(7-10(8)11)9-4-5-9;;/h1-3,9H,4-7,12H2;2*1H

InChI key: InChIKey=GQIUIIYCIZEKJA-UHFFFAOYSA-N

SMILES: NC1=C2CN(CC2=CC=C1)C3CC3.Cl

Synonyms:

• 1H-Isoindol-4-amine, 2-cyclopropyl-2,3-dihydro-, hydrochloride (1:2)

2-Cyclopropyl-2,3-dihydro-1H-isoindol-4-amine dihydrochloride

CAS: 1432681-28-1

Versatile small molecule scaffold

Formula: C₁₁H₁₆Cl₂N₂

Purity: Min. 95%

Molecular weight: 247.16 g/mol

Ref: 3D-HHC68128