CAS 1432681-30-5

1H-Tetrazole-5-ethanamine, 1-methyl-, hydrochloride (1:1)

Description:

1H-Tetrazole-5-ethanamine, 1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its tetrazole ring structure, which is a five-membered aromatic ring containing four nitrogen atoms and one carbon atom. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in pharmaceuticals and organic synthesis. The presence of the ethylamine and methyl groups contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its unique structure imparts properties that may be beneficial in medicinal chemistry, particularly in the development of bioactive compounds. Additionally, the compound's stability and solubility profile make it a candidate for further research in drug formulation and delivery systems. As with many nitrogen-containing heterocycles, it may exhibit interesting biological activities, warranting investigation into its pharmacological potential. Safety and handling precautions should be observed due to the presence of nitrogen-rich functional groups.

Formula: C₄H₉N₅·ClH

InChI: InChI=1S/C4H9N5.ClH/c1-9-4(2-3-5)6-7-8-9;/h2-3,5H2,1H3;1H

InChI key: InChIKey=QZTIGPIJFJZNMN-UHFFFAOYSA-N

SMILES: C(CN)C=1N(C)N=NN1.Cl

Synonyms:

• 1H-Tetrazole-5-ethanamine, 1-methyl-, hydrochloride (1:1)

2-(1-Methyl-1H-1,2,3,4-tetrazol-5-yl)ethan-1-amine hydrochloride

CAS: 1432681-30-5

Versatile small molecule scaffold

Formula: C₄H₁₀ClN₅

Purity: Min. 95%

Molecular weight: 163.61 g/mol

Ref: 3D-HHC68130